C29H30F3N5O — CID 121464692
(1S)-1-[4-[3-[(6R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl]-8-aminoimidazo[1,5-a]pyrazin-1-yl]phenyl]-1-[3-(trifluoromethyl)phenyl]ethanol (PubChem CID 121464692) has the molecular formula C29H30F3N5O and a molecular weight of 521.59 g/mol. Its IUPAC name is (1S)-1-[4-[3-[(6R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl]-8-aminoimidazo[1,5-a]pyrazin-1-yl]phenyl]-1-[3-(trifluoromethyl)phenyl]ethanol.
| Compound Name | (1S)-1-[4-[3-[(6R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl]-8-aminoimidazo[1,5-a]pyrazin-1-yl]phenyl]-1-[3-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 121464692 |
| Molecular Formula | C29H30F3N5O |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | (1S)-1-[4-[3-[(6R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl]-8-aminoimidazo[1,5-a]pyrazin-1-yl]phenyl]-1-[3-(trifluoromethyl)phenyl]ethanol |
| SMILES | C[C@](O)(c1ccc(-c2nc([C@@H]3CC[C@H]4CCCN4C3)n3ccnc(N)c23)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H30F3N5O/c1-28(38,21-4-2-5-22(16-21)29(30,31)32)20-10-7-18(8-11-20)24-25-26(33)34-13-15-37(25)27(35-24)19-9-12-23-6-3-14-36(23)17-19/h2,4-5,7-8,10-11,13,15-16,19,23,38H,3,6,9,12,14,17H2,1H3,(H2,33,34)/t19-,23-,28+/m1/s1 |
| InChIKey | LDAOMKUEORKXPG-VZQQDINASA-N |
| XLogP | 5.59 |
| TPSA | 79.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |