C29H31N5O2 — CID 121464695
(6R,8aS)-6-[8-amino-1-[4-[(1R)-1-hydroxy-1-(3-methylphenyl)ethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 121464695) has the molecular formula C29H31N5O2 and a molecular weight of 481.60 g/mol. Its IUPAC name is (6R,8aS)-6-[8-amino-1-[4-[(1R)-1-hydroxy-1-(3-methylphenyl)ethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (6R,8aS)-6-[8-amino-1-[4-[(1R)-1-hydroxy-1-(3-methylphenyl)ethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 121464695 |
| Molecular Formula | C29H31N5O2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | (6R,8aS)-6-[8-amino-1-[4-[(1R)-1-hydroxy-1-(3-methylphenyl)ethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | Cc1cccc([C@](C)(O)c2ccc(-c3nc([C@@H]4CC[C@H]5CCC(=O)N5C4)n4ccnc(N)c34)cc2)c1 |
| InChI | InChI=1S/C29H31N5O2/c1-18-4-3-5-22(16-18)29(2,36)21-9-6-19(7-10-21)25-26-27(30)31-14-15-33(26)28(32-25)20-8-11-23-12-13-24(35)34(23)17-20/h3-7,9-10,14-16,20,23,36H,8,11-13,17H2,1-2H3,(H2,30,31)/t20-,23+,29-/m1/s1 |
| InChIKey | SADFCIRZMFIHDL-YOZPAVSOSA-N |
| XLogP | 4.41 |
| TPSA | 96.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |