C28H30N4O2 — CID 121464712
(3S)-3-amino-3-[5-[(2S)-butan-2-yl]-1,3,4-oxadiazol-2-yl]-N-tritylpropanamide (PubChem CID 121464712) has the molecular formula C28H30N4O2 and a molecular weight of 454.57 g/mol. Its IUPAC name is (3S)-3-amino-3-[5-[(2S)-butan-2-yl]-1,3,4-oxadiazol-2-yl]-N-tritylpropanamide.
| Compound Name | (3S)-3-amino-3-[5-[(2S)-butan-2-yl]-1,3,4-oxadiazol-2-yl]-N-tritylpropanamide |
|---|---|
| PubChem CID | 121464712 |
| Molecular Formula | C28H30N4O2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | (3S)-3-amino-3-[5-[(2S)-butan-2-yl]-1,3,4-oxadiazol-2-yl]-N-tritylpropanamide |
| SMILES | CC[C@H](C)c1nnc([C@@H](N)CC(=O)NC(c2ccccc2)(c2ccccc2)c2ccccc2)o1 |
| InChI | InChI=1S/C28H30N4O2/c1-3-20(2)26-31-32-27(34-26)24(29)19-25(33)30-28(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h4-18,20,24H,3,19,29H2,1-2H3,(H,30,33)/t20-,24-/m0/s1 |
| InChIKey | PRTZLMQIXFNBQQ-RDPSFJRHSA-N |
| XLogP | 5.08 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|