About (4-fluorophenyl)methyl N-[2-(1,3-benzothiazole-2-carbonylamino)thiophene-3-carbonyl]carbamate
(4-fluorophenyl)methyl N-[2-(1,3-benzothiazole-2-carbonylamino)thiophene-3-carbonyl]carbamate (PubChem CID 121464891) has the molecular formula C21H14FN3O4S2
and a molecular weight of 455.49 g/mol. Its IUPAC name is (4-fluorophenyl)methyl N-[2-(1,3-benzothiazole-2-carbonylamino)thiophene-3-carbonyl]carbamate.
Molecular Properties
| Compound Name | (4-fluorophenyl)methyl N-[2-(1,3-benzothiazole-2-carbonylamino)thiophene-3-carbonyl]carbamate |
| PubChem CID | 121464891 |
| Molecular Formula | C21H14FN3O4S2 |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | (4-fluorophenyl)methyl N-[2-(1,3-benzothiazole-2-carbonylamino)thiophene-3-carbonyl]carbamate |
| SMILES | O=C(NC(=O)c1ccsc1NC(=O)c1nc2ccccc2s1)OCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H14FN3O4S2/c22-13-7-5-12(6-8-13)11-29-21(28)25-17(26)14-9-10-30-19(14)24-18(27)20-23-15-3-1-2-4-16(15)31-20/h1-10H,11H2,(H,24,27)(H,25,26,28) |
| InChIKey | SIOCMDXIQOYYPX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (4-fluorophenyl)methyl N-[2-(1,3-benzothiazole-2-carbonylamino)thiophene-3-carbonyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl)methyl N-[2-(1,3-benzothiazole-2-carbonylamino)thiophene-3-carbonyl]carbamate?
The IUPAC name of (4-fluorophenyl)methyl N-[2-(1,3-benzothiazole-2-carbonylamino)thiophene-3-carbonyl]carbamate (CID 121464891) is (4-fluorophenyl)methyl N-[2-(1,3-benzothiazole-2-carbonylamino)thiophene-3-carbonyl]carbamate.
What is the SMILES notation for (4-fluorophenyl)methyl N-[2-(1,3-benzothiazole-2-carbonylamino)thiophene-3-carbonyl]carbamate?
The canonical SMILES for (4-fluorophenyl)methyl N-[2-(1,3-benzothiazole-2-carbonylamino)thiophene-3-carbonyl]carbamate is O=C(NC(=O)c1ccsc1NC(=O)c1nc2ccccc2s1)OCc1ccc(F)cc1.
What is the InChIKey of (4-fluorophenyl)methyl N-[2-(1,3-benzothiazole-2-carbonylamino)thiophene-3-carbonyl]carbamate?
The InChIKey is SIOCMDXIQOYYPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14FN3O4S2/c22-13-7-5-12(6-8-13)11-29-21(28)25-17(26)14-9-10-30-19(14)24-18(27)20-23-15-3-1-2-4-16(15)31-20/h1-10H,11H2,(H,24,27)(H,25,26,28).
What are the key properties of (4-fluorophenyl)methyl N-[2-(1,3-benzothiazole-2-carbonylamino)thiophene-3-carbonyl]carbamate?
(4-fluorophenyl)methyl N-[2-(1,3-benzothiazole-2-carbonylamino)thiophene-3-carbonyl]carbamate has a molecular weight of 455.49 g/mol, XLogP of 4.82, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl)methyl N-[2-(1,3-benzothiazole-2-carbonylamino)thiophene-3-carbonyl]carbamate is sourced from PubChem (CID 121464891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).