About methyl N-[2-(pyrazolo[1,5-a]pyrimidine-6-carbonylamino)thiophene-3-carbonyl]carbamate
methyl N-[2-(pyrazolo[1,5-a]pyrimidine-6-carbonylamino)thiophene-3-carbonyl]carbamate (PubChem CID 121464931) has the molecular formula C14H11N5O4S
and a molecular weight of 345.34 g/mol. Its IUPAC name is methyl N-[2-(pyrazolo[1,5-a]pyrimidine-6-carbonylamino)thiophene-3-carbonyl]carbamate.
Molecular Properties
| Compound Name | methyl N-[2-(pyrazolo[1,5-a]pyrimidine-6-carbonylamino)thiophene-3-carbonyl]carbamate |
| PubChem CID | 121464931 |
| Molecular Formula | C14H11N5O4S |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | methyl N-[2-(pyrazolo[1,5-a]pyrimidine-6-carbonylamino)thiophene-3-carbonyl]carbamate |
| SMILES | COC(=O)NC(=O)c1ccsc1NC(=O)c1cnc2ccnn2c1 |
| InChI | InChI=1S/C14H11N5O4S/c1-23-14(22)18-12(21)9-3-5-24-13(9)17-11(20)8-6-15-10-2-4-16-19(10)7-8/h2-7H,1H3,(H,17,20)(H,18,21,22) |
| InChIKey | VRPWHENCUAZXBA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl N-[2-(pyrazolo[1,5-a]pyrimidine-6-carbonylamino)thiophene-3-carbonyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[2-(pyrazolo[1,5-a]pyrimidine-6-carbonylamino)thiophene-3-carbonyl]carbamate?
The IUPAC name of methyl N-[2-(pyrazolo[1,5-a]pyrimidine-6-carbonylamino)thiophene-3-carbonyl]carbamate (CID 121464931) is methyl N-[2-(pyrazolo[1,5-a]pyrimidine-6-carbonylamino)thiophene-3-carbonyl]carbamate.
What is the SMILES notation for methyl N-[2-(pyrazolo[1,5-a]pyrimidine-6-carbonylamino)thiophene-3-carbonyl]carbamate?
The canonical SMILES for methyl N-[2-(pyrazolo[1,5-a]pyrimidine-6-carbonylamino)thiophene-3-carbonyl]carbamate is COC(=O)NC(=O)c1ccsc1NC(=O)c1cnc2ccnn2c1.
What is the InChIKey of methyl N-[2-(pyrazolo[1,5-a]pyrimidine-6-carbonylamino)thiophene-3-carbonyl]carbamate?
The InChIKey is VRPWHENCUAZXBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N5O4S/c1-23-14(22)18-12(21)9-3-5-24-13(9)17-11(20)8-6-15-10-2-4-16-19(10)7-8/h2-7H,1H3,(H,17,20)(H,18,21,22).
What are the key properties of methyl N-[2-(pyrazolo[1,5-a]pyrimidine-6-carbonylamino)thiophene-3-carbonyl]carbamate?
methyl N-[2-(pyrazolo[1,5-a]pyrimidine-6-carbonylamino)thiophene-3-carbonyl]carbamate has a molecular weight of 345.34 g/mol, XLogP of 1.54, 3 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[2-(pyrazolo[1,5-a]pyrimidine-6-carbonylamino)thiophene-3-carbonyl]carbamate is sourced from PubChem (CID 121464931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).