About ethyl N-[2-[(2-cyclopropyl-1,3-benzothiazole-5-carbonyl)amino]thiophene-3-carbonyl]carbamate
ethyl N-[2-[(2-cyclopropyl-1,3-benzothiazole-5-carbonyl)amino]thiophene-3-carbonyl]carbamate (PubChem CID 121464997) has the molecular formula C19H17N3O4S2
and a molecular weight of 415.50 g/mol. Its IUPAC name is ethyl N-[2-[(2-cyclopropyl-1,3-benzothiazole-5-carbonyl)amino]thiophene-3-carbonyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[2-[(2-cyclopropyl-1,3-benzothiazole-5-carbonyl)amino]thiophene-3-carbonyl]carbamate |
| PubChem CID | 121464997 |
| Molecular Formula | C19H17N3O4S2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | ethyl N-[2-[(2-cyclopropyl-1,3-benzothiazole-5-carbonyl)amino]thiophene-3-carbonyl]carbamate |
| SMILES | CCOC(=O)NC(=O)c1ccsc1NC(=O)c1ccc2sc(C3CC3)nc2c1 |
| InChI | InChI=1S/C19H17N3O4S2/c1-2-26-19(25)22-16(24)12-7-8-27-18(12)21-15(23)11-5-6-14-13(9-11)20-17(28-14)10-3-4-10/h5-10H,2-4H2,1H3,(H,21,23)(H,22,24,25) |
| InChIKey | SRYGYSAZRXLWJI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl N-[2-[(2-cyclopropyl-1,3-benzothiazole-5-carbonyl)amino]thiophene-3-carbonyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[2-[(2-cyclopropyl-1,3-benzothiazole-5-carbonyl)amino]thiophene-3-carbonyl]carbamate?
The IUPAC name of ethyl N-[2-[(2-cyclopropyl-1,3-benzothiazole-5-carbonyl)amino]thiophene-3-carbonyl]carbamate (CID 121464997) is ethyl N-[2-[(2-cyclopropyl-1,3-benzothiazole-5-carbonyl)amino]thiophene-3-carbonyl]carbamate.
What is the SMILES notation for ethyl N-[2-[(2-cyclopropyl-1,3-benzothiazole-5-carbonyl)amino]thiophene-3-carbonyl]carbamate?
The canonical SMILES for ethyl N-[2-[(2-cyclopropyl-1,3-benzothiazole-5-carbonyl)amino]thiophene-3-carbonyl]carbamate is CCOC(=O)NC(=O)c1ccsc1NC(=O)c1ccc2sc(C3CC3)nc2c1.
What is the InChIKey of ethyl N-[2-[(2-cyclopropyl-1,3-benzothiazole-5-carbonyl)amino]thiophene-3-carbonyl]carbamate?
The InChIKey is SRYGYSAZRXLWJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O4S2/c1-2-26-19(25)22-16(24)12-7-8-27-18(12)21-15(23)11-5-6-14-13(9-11)20-17(28-14)10-3-4-10/h5-10H,2-4H2,1H3,(H,21,23)(H,22,24,25).
What are the key properties of ethyl N-[2-[(2-cyclopropyl-1,3-benzothiazole-5-carbonyl)amino]thiophene-3-carbonyl]carbamate?
ethyl N-[2-[(2-cyclopropyl-1,3-benzothiazole-5-carbonyl)amino]thiophene-3-carbonyl]carbamate has a molecular weight of 415.50 g/mol, XLogP of 4.37, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[2-[(2-cyclopropyl-1,3-benzothiazole-5-carbonyl)amino]thiophene-3-carbonyl]carbamate is sourced from PubChem (CID 121464997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).