About ethyl N-[2-[(6-methylidene-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]thiophene-3-carbonyl]carbamate
ethyl N-[2-[(6-methylidene-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]thiophene-3-carbonyl]carbamate (PubChem CID 121465048) has the molecular formula C14H16N4O4S
and a molecular weight of 336.37 g/mol. Its IUPAC name is ethyl N-[2-[(6-methylidene-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]thiophene-3-carbonyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[2-[(6-methylidene-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]thiophene-3-carbonyl]carbamate |
| PubChem CID | 121465048 |
| Molecular Formula | C14H16N4O4S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | ethyl N-[2-[(6-methylidene-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]thiophene-3-carbonyl]carbamate |
| SMILES | C=C1CCC(C(=O)Nc2sccc2C(=O)NC(=O)OCC)=NN1 |
| InChI | InChI=1S/C14H16N4O4S/c1-3-22-14(21)16-11(19)9-6-7-23-13(9)15-12(20)10-5-4-8(2)17-18-10/h6-7,17H,2-5H2,1H3,(H,15,20)(H,16,19,21) |
| InChIKey | ITPXKMSICPIOCJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl N-[2-[(6-methylidene-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]thiophene-3-carbonyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[2-[(6-methylidene-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]thiophene-3-carbonyl]carbamate?
The IUPAC name of ethyl N-[2-[(6-methylidene-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]thiophene-3-carbonyl]carbamate (CID 121465048) is ethyl N-[2-[(6-methylidene-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]thiophene-3-carbonyl]carbamate.
What is the SMILES notation for ethyl N-[2-[(6-methylidene-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]thiophene-3-carbonyl]carbamate?
The canonical SMILES for ethyl N-[2-[(6-methylidene-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]thiophene-3-carbonyl]carbamate is C=C1CCC(C(=O)Nc2sccc2C(=O)NC(=O)OCC)=NN1.
What is the InChIKey of ethyl N-[2-[(6-methylidene-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]thiophene-3-carbonyl]carbamate?
The InChIKey is ITPXKMSICPIOCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O4S/c1-3-22-14(21)16-11(19)9-6-7-23-13(9)15-12(20)10-5-4-8(2)17-18-10/h6-7,17H,2-5H2,1H3,(H,15,20)(H,16,19,21).
What are the key properties of ethyl N-[2-[(6-methylidene-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]thiophene-3-carbonyl]carbamate?
ethyl N-[2-[(6-methylidene-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]thiophene-3-carbonyl]carbamate has a molecular weight of 336.37 g/mol, XLogP of 1.83, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[2-[(6-methylidene-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]thiophene-3-carbonyl]carbamate is sourced from PubChem (CID 121465048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).