About [(2S,3R)-3-(cyclopropylmethoxy)-5-methylhexan-2-yl] (2S)-2-aminopropanoate
[(2S,3R)-3-(cyclopropylmethoxy)-5-methylhexan-2-yl] (2S)-2-aminopropanoate (PubChem CID 121466557) has the molecular formula C14H27NO3
and a molecular weight of 257.37 g/mol. Its IUPAC name is [(2S,3R)-3-(cyclopropylmethoxy)-5-methylhexan-2-yl] (2S)-2-aminopropanoate.
Molecular Properties
| Compound Name | [(2S,3R)-3-(cyclopropylmethoxy)-5-methylhexan-2-yl] (2S)-2-aminopropanoate |
| PubChem CID | 121466557 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | [(2S,3R)-3-(cyclopropylmethoxy)-5-methylhexan-2-yl] (2S)-2-aminopropanoate |
| SMILES | CC(C)C[C@@H](OCC1CC1)[C@H](C)OC(=O)[C@H](C)N |
| InChI | InChI=1S/C14H27NO3/c1-9(2)7-13(17-8-12-5-6-12)11(4)18-14(16)10(3)15/h9-13H,5-8,15H2,1-4H3/t10-,11-,13+/m0/s1 |
| InChIKey | NUOGHUUXJPHRNJ-GMXVVIOVSA-N |
| XLogP | 2.11 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S,3R)-3-(cyclopropylmethoxy)-5-methylhexan-2-yl] (2S)-2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3R)-3-(cyclopropylmethoxy)-5-methylhexan-2-yl] (2S)-2-aminopropanoate?
The IUPAC name of [(2S,3R)-3-(cyclopropylmethoxy)-5-methylhexan-2-yl] (2S)-2-aminopropanoate (CID 121466557) is [(2S,3R)-3-(cyclopropylmethoxy)-5-methylhexan-2-yl] (2S)-2-aminopropanoate.
What is the SMILES notation for [(2S,3R)-3-(cyclopropylmethoxy)-5-methylhexan-2-yl] (2S)-2-aminopropanoate?
The canonical SMILES for [(2S,3R)-3-(cyclopropylmethoxy)-5-methylhexan-2-yl] (2S)-2-aminopropanoate is CC(C)C[C@@H](OCC1CC1)[C@H](C)OC(=O)[C@H](C)N.
What is the InChIKey of [(2S,3R)-3-(cyclopropylmethoxy)-5-methylhexan-2-yl] (2S)-2-aminopropanoate?
The InChIKey is NUOGHUUXJPHRNJ-GMXVVIOVSA-N. The full InChI is InChI=1S/C14H27NO3/c1-9(2)7-13(17-8-12-5-6-12)11(4)18-14(16)10(3)15/h9-13H,5-8,15H2,1-4H3/t10-,11-,13+/m0/s1.
What are the key properties of [(2S,3R)-3-(cyclopropylmethoxy)-5-methylhexan-2-yl] (2S)-2-aminopropanoate?
[(2S,3R)-3-(cyclopropylmethoxy)-5-methylhexan-2-yl] (2S)-2-aminopropanoate has a molecular weight of 257.37 g/mol, XLogP of 2.11, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3R)-3-(cyclopropylmethoxy)-5-methylhexan-2-yl] (2S)-2-aminopropanoate is sourced from PubChem (CID 121466557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).