C32H30N4O4S — CID 121466894
2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]ethyl (E)-2-cyano-3-pyren-1-ylprop-2-enoate (PubChem CID 121466894) has the molecular formula C32H30N4O4S and a molecular weight of 566.68 g/mol. Its IUPAC name is 2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]ethyl (E)-2-cyano-3-pyren-1-ylprop-2-enoate.
| Compound Name | 2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]ethyl (E)-2-cyano-3-pyren-1-ylprop-2-enoate |
|---|---|
| PubChem CID | 121466894 |
| Molecular Formula | C32H30N4O4S |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | 2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]ethyl (E)-2-cyano-3-pyren-1-ylprop-2-enoate |
| SMILES | N#C/C(=C\c1ccc2ccc3cccc4ccc1c2c34)C(=O)OCCNC(=O)CCCCC1SCC2NC(=O)NC21 |
| InChI | InChI=1S/C32H30N4O4S/c33-17-23(16-22-11-10-21-9-8-19-4-3-5-20-12-13-24(22)29(21)28(19)20)31(38)40-15-14-34-27(37)7-2-1-6-26-30-25(18-41-26)35-32(39)36-30/h3-5,8-13,16,25-26,30H,1-2,6-7,14-15,18H2,(H,34,37)(H2,35,36,39)/b23-16+ |
| InChIKey | JWXSAYBWUPUOPJ-XQNSMLJCSA-N |
| XLogP | 4.88 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|