C16H22N4O6S3 — CID 121467011
ethyl N-[2-[(5-methylsulfonyl-2,3a,4,6,7,7a-hexahydro-1H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]thiophene-3-carbonyl]carbamate (PubChem CID 121467011) has the molecular formula C16H22N4O6S3 and a molecular weight of 462.58 g/mol. Its IUPAC name is ethyl N-[2-[(5-methylsulfonyl-2,3a,4,6,7,7a-hexahydro-1H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]thiophene-3-carbonyl]carbamate.
| Compound Name | ethyl N-[2-[(5-methylsulfonyl-2,3a,4,6,7,7a-hexahydro-1H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]thiophene-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 121467011 |
| Molecular Formula | C16H22N4O6S3 |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | ethyl N-[2-[(5-methylsulfonyl-2,3a,4,6,7,7a-hexahydro-1H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]thiophene-3-carbonyl]carbamate |
| SMILES | CCOC(=O)NC(=O)c1ccsc1NC(=O)C1NC2CCN(S(C)(=O)=O)CC2S1 |
| InChI | InChI=1S/C16H22N4O6S3/c1-3-26-16(23)19-12(21)9-5-7-27-14(9)18-13(22)15-17-10-4-6-20(29(2,24)25)8-11(10)28-15/h5,7,10-11,15,17H,3-4,6,8H2,1-2H3,(H,18,22)(H,19,21,23) |
| InChIKey | VGAXOMIZZURSIW-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |