About 2-[4-[2-(1-naphthalen-1-ylethylamino)pyrrolidin-1-yl]phenyl]acetic acid;hydrobromide
2-[4-[2-(1-naphthalen-1-ylethylamino)pyrrolidin-1-yl]phenyl]acetic acid;hydrobromide (PubChem CID 121468318) has the molecular formula C24H27BrN2O2
and a molecular weight of 455.40 g/mol. Its IUPAC name is 2-[4-[2-(1-naphthalen-1-ylethylamino)pyrrolidin-1-yl]phenyl]acetic acid;hydrobromide.
Molecular Properties
| Compound Name | 2-[4-[2-(1-naphthalen-1-ylethylamino)pyrrolidin-1-yl]phenyl]acetic acid;hydrobromide |
| PubChem CID | 121468318 |
| Molecular Formula | C24H27BrN2O2 |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 2-[4-[2-(1-naphthalen-1-ylethylamino)pyrrolidin-1-yl]phenyl]acetic acid;hydrobromide |
| SMILES | Br.CC(NC1CCCN1c1ccc(CC(=O)O)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H26N2O2.BrH/c1-17(21-9-4-7-19-6-2-3-8-22(19)21)25-23-10-5-15-26(23)20-13-11-18(12-14-20)16-24(27)28;/h2-4,6-9,11-14,17,23,25H,5,10,15-16H2,1H3,(H,27,28);1H |
| InChIKey | NELFYXOTKLRNAO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[2-(1-naphthalen-1-ylethylamino)pyrrolidin-1-yl]phenyl]acetic acid;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-(1-naphthalen-1-ylethylamino)pyrrolidin-1-yl]phenyl]acetic acid;hydrobromide?
The IUPAC name of 2-[4-[2-(1-naphthalen-1-ylethylamino)pyrrolidin-1-yl]phenyl]acetic acid;hydrobromide (CID 121468318) is 2-[4-[2-(1-naphthalen-1-ylethylamino)pyrrolidin-1-yl]phenyl]acetic acid;hydrobromide.
What is the SMILES notation for 2-[4-[2-(1-naphthalen-1-ylethylamino)pyrrolidin-1-yl]phenyl]acetic acid;hydrobromide?
The canonical SMILES for 2-[4-[2-(1-naphthalen-1-ylethylamino)pyrrolidin-1-yl]phenyl]acetic acid;hydrobromide is Br.CC(NC1CCCN1c1ccc(CC(=O)O)cc1)c1cccc2ccccc12.
What is the InChIKey of 2-[4-[2-(1-naphthalen-1-ylethylamino)pyrrolidin-1-yl]phenyl]acetic acid;hydrobromide?
The InChIKey is NELFYXOTKLRNAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N2O2.BrH/c1-17(21-9-4-7-19-6-2-3-8-22(19)21)25-23-10-5-15-26(23)20-13-11-18(12-14-20)16-24(27)28;/h2-4,6-9,11-14,17,23,25H,5,10,15-16H2,1H3,(H,27,28);1H.
What are the key properties of 2-[4-[2-(1-naphthalen-1-ylethylamino)pyrrolidin-1-yl]phenyl]acetic acid;hydrobromide?
2-[4-[2-(1-naphthalen-1-ylethylamino)pyrrolidin-1-yl]phenyl]acetic acid;hydrobromide has a molecular weight of 455.40 g/mol, XLogP of 5.32, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(1-naphthalen-1-ylethylamino)pyrrolidin-1-yl]phenyl]acetic acid;hydrobromide is sourced from PubChem (CID 121468318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).