C27H33N3O3 — CID 121468664
6-[8-[(3-ethylphenyl)methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]-2,2-dimethyl-6-oxohexanoic acid (PubChem CID 121468664) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is 6-[8-[(3-ethylphenyl)methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]-2,2-dimethyl-6-oxohexanoic acid.
| Compound Name | 6-[8-[(3-ethylphenyl)methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]-2,2-dimethyl-6-oxohexanoic acid |
|---|---|
| PubChem CID | 121468664 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 6-[8-[(3-ethylphenyl)methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]-2,2-dimethyl-6-oxohexanoic acid |
| SMILES | CCc1cccc(Cn2c3c(c4cccnc42)CCN(C(=O)CCCC(C)(C)C(=O)O)C3)c1 |
| InChI | InChI=1S/C27H33N3O3/c1-4-19-8-5-9-20(16-19)17-30-23-18-29(24(31)11-6-13-27(2,3)26(32)33)15-12-21(23)22-10-7-14-28-25(22)30/h5,7-10,14,16H,4,6,11-13,15,17-18H2,1-3H3,(H,32,33) |
| InChIKey | DNBIJNKEBPECEA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |