C28H39N7O — CID 121469145
1-[2-[bis(2-methylpropyl)amino]-5-[2-(2H-tetrazol-5-yl)phenyl]phenyl]-3-cyclohexylurea (PubChem CID 121469145) has the molecular formula C28H39N7O and a molecular weight of 489.67 g/mol. Its IUPAC name is 1-[2-[bis(2-methylpropyl)amino]-5-[2-(2H-tetrazol-5-yl)phenyl]phenyl]-3-cyclohexylurea.
| Compound Name | 1-[2-[bis(2-methylpropyl)amino]-5-[2-(2H-tetrazol-5-yl)phenyl]phenyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 121469145 |
| Molecular Formula | C28H39N7O |
| Molecular Weight | 489.67 g/mol |
| Exact Mass | 489.32 |
| IUPAC Name | 1-[2-[bis(2-methylpropyl)amino]-5-[2-(2H-tetrazol-5-yl)phenyl]phenyl]-3-cyclohexylurea |
| SMILES | CC(C)CN(CC(C)C)c1ccc(-c2ccccc2-c2nn[nH]n2)cc1NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C28H39N7O/c1-19(2)17-35(18-20(3)4)26-15-14-21(23-12-8-9-13-24(23)27-31-33-34-32-27)16-25(26)30-28(36)29-22-10-6-5-7-11-22/h8-9,12-16,19-20,22H,5-7,10-11,17-18H2,1-4H3,(H2,29,30,36)(H,31,32,33,34) |
| InChIKey | RJQMALRLUIVRBL-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.67 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |