C21H42O5 — CID 121470294
3,5,5-trimethylhexyl 4-[2-(2-butoxyethoxy)ethoxy]butanoate (PubChem CID 121470294) has the molecular formula C21H42O5 and a molecular weight of 374.56 g/mol. Its IUPAC name is 3,5,5-trimethylhexyl 4-[2-(2-butoxyethoxy)ethoxy]butanoate.
| Compound Name | 3,5,5-trimethylhexyl 4-[2-(2-butoxyethoxy)ethoxy]butanoate |
|---|---|
| PubChem CID | 121470294 |
| Molecular Formula | C21H42O5 |
| Molecular Weight | 374.56 g/mol |
| Exact Mass | 374.30 |
| IUPAC Name | 3,5,5-trimethylhexyl 4-[2-(2-butoxyethoxy)ethoxy]butanoate |
| SMILES | CCCCOCCOCCOCCCC(=O)OCCC(C)CC(C)(C)C |
| InChI | InChI=1S/C21H42O5/c1-6-7-11-23-14-16-25-17-15-24-12-8-9-20(22)26-13-10-19(2)18-21(3,4)5/h19H,6-18H2,1-5H3 |
| InChIKey | XGIBOBNKBDSRHZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|