About 2-hexyldecyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate
2-hexyldecyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate (PubChem CID 121470321) has the molecular formula C32H64O5
and a molecular weight of 528.86 g/mol. Its IUPAC name is 2-hexyldecyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate.
Molecular Properties
| Compound Name | 2-hexyldecyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate |
| PubChem CID | 121470321 |
| Molecular Formula | C32H64O5 |
| Molecular Weight | 528.86 g/mol |
| Exact Mass | 528.48 |
| IUPAC Name | 2-hexyldecyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate |
| SMILES | CCCCCCCCOCCOCCOCCCC(=O)OCC(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C32H64O5/c1-4-7-10-13-15-18-22-31(21-17-12-9-6-3)30-37-32(33)23-20-25-35-27-29-36-28-26-34-24-19-16-14-11-8-5-2/h31H,4-30H2,1-3H3 |
| InChIKey | IHMBPXVOTCJFRD-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 528.86 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hexyldecyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexyldecyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate?
The IUPAC name of 2-hexyldecyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate (CID 121470321) is 2-hexyldecyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate.
What is the SMILES notation for 2-hexyldecyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate?
The canonical SMILES for 2-hexyldecyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate is CCCCCCCCOCCOCCOCCCC(=O)OCC(CCCCCC)CCCCCCCC.
What is the InChIKey of 2-hexyldecyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate?
The InChIKey is IHMBPXVOTCJFRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H64O5/c1-4-7-10-13-15-18-22-31(21-17-12-9-6-3)30-37-32(33)23-20-25-35-27-29-36-28-26-34-24-19-16-14-11-8-5-2/h31H,4-30H2,1-3H3.
What are the key properties of 2-hexyldecyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate?
2-hexyldecyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate has a molecular weight of 528.86 g/mol, XLogP of 9.06, 31 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexyldecyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate is sourced from PubChem (CID 121470321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).