About 6,6-ditert-butyl-2-(2-hydroxy-5-methylphenyl)sulfanyl-4-methylcyclohexa-1,3-dien-1-ol
6,6-ditert-butyl-2-(2-hydroxy-5-methylphenyl)sulfanyl-4-methylcyclohexa-1,3-dien-1-ol (PubChem CID 121470730) has the molecular formula C22H32O2S
and a molecular weight of 360.56 g/mol. Its IUPAC name is 6,6-ditert-butyl-2-(2-hydroxy-5-methylphenyl)sulfanyl-4-methylcyclohexa-1,3-dien-1-ol.
Molecular Properties
| Compound Name | 6,6-ditert-butyl-2-(2-hydroxy-5-methylphenyl)sulfanyl-4-methylcyclohexa-1,3-dien-1-ol |
| PubChem CID | 121470730 |
| Molecular Formula | C22H32O2S |
| Molecular Weight | 360.56 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 6,6-ditert-butyl-2-(2-hydroxy-5-methylphenyl)sulfanyl-4-methylcyclohexa-1,3-dien-1-ol |
| SMILES | CC1=CC(Sc2cc(C)ccc2O)=C(O)C(C(C)(C)C)(C(C)(C)C)C1 |
| InChI | InChI=1S/C22H32O2S/c1-14-9-10-16(23)17(11-14)25-18-12-15(2)13-22(19(18)24,20(3,4)5)21(6,7)8/h9-12,23-24H,13H2,1-8H3 |
| InChIKey | YWRISWGHCXLLTG-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.56 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,6-ditert-butyl-2-(2-hydroxy-5-methylphenyl)sulfanyl-4-methylcyclohexa-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-ditert-butyl-2-(2-hydroxy-5-methylphenyl)sulfanyl-4-methylcyclohexa-1,3-dien-1-ol?
The IUPAC name of 6,6-ditert-butyl-2-(2-hydroxy-5-methylphenyl)sulfanyl-4-methylcyclohexa-1,3-dien-1-ol (CID 121470730) is 6,6-ditert-butyl-2-(2-hydroxy-5-methylphenyl)sulfanyl-4-methylcyclohexa-1,3-dien-1-ol.
What is the SMILES notation for 6,6-ditert-butyl-2-(2-hydroxy-5-methylphenyl)sulfanyl-4-methylcyclohexa-1,3-dien-1-ol?
The canonical SMILES for 6,6-ditert-butyl-2-(2-hydroxy-5-methylphenyl)sulfanyl-4-methylcyclohexa-1,3-dien-1-ol is CC1=CC(Sc2cc(C)ccc2O)=C(O)C(C(C)(C)C)(C(C)(C)C)C1.
What is the InChIKey of 6,6-ditert-butyl-2-(2-hydroxy-5-methylphenyl)sulfanyl-4-methylcyclohexa-1,3-dien-1-ol?
The InChIKey is YWRISWGHCXLLTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32O2S/c1-14-9-10-16(23)17(11-14)25-18-12-15(2)13-22(19(18)24,20(3,4)5)21(6,7)8/h9-12,23-24H,13H2,1-8H3.
What are the key properties of 6,6-ditert-butyl-2-(2-hydroxy-5-methylphenyl)sulfanyl-4-methylcyclohexa-1,3-dien-1-ol?
6,6-ditert-butyl-2-(2-hydroxy-5-methylphenyl)sulfanyl-4-methylcyclohexa-1,3-dien-1-ol has a molecular weight of 360.56 g/mol, XLogP of 6.99, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-ditert-butyl-2-(2-hydroxy-5-methylphenyl)sulfanyl-4-methylcyclohexa-1,3-dien-1-ol is sourced from PubChem (CID 121470730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).