C16H14N4O2 — CID 121471746
5-[(4-methoxyphenyl)methyl]-2,4,7,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-3-one (PubChem CID 121471746) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)methyl]-2,4,7,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-3-one.
| Compound Name | 5-[(4-methoxyphenyl)methyl]-2,4,7,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-3-one |
|---|---|
| PubChem CID | 121471746 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 5-[(4-methoxyphenyl)methyl]-2,4,7,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-3-one |
| SMILES | COc1ccc(CC2NC(=O)n3c2nc2ccncc23)cc1 |
| InChI | InChI=1S/C16H14N4O2/c1-22-11-4-2-10(3-5-11)8-13-15-18-12-6-7-17-9-14(12)20(15)16(21)19-13/h2-7,9,13H,8H2,1H3,(H,19,21) |
| InChIKey | PRKNYGIDTPTAMS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |