C30H35NO7S — CID 121471787
2-[6-[[3-[2,6-diethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methoxy]-2,3-dihydrofuro[3,2-c]pyridin-3-yl]acetic acid (PubChem CID 121471787) has the molecular formula C30H35NO7S and a molecular weight of 553.68 g/mol. Its IUPAC name is 2-[6-[[3-[2,6-diethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methoxy]-2,3-dihydrofuro[3,2-c]pyridin-3-yl]acetic acid.
| Compound Name | 2-[6-[[3-[2,6-diethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methoxy]-2,3-dihydrofuro[3,2-c]pyridin-3-yl]acetic acid |
|---|---|
| PubChem CID | 121471787 |
| Molecular Formula | C30H35NO7S |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.21 |
| IUPAC Name | 2-[6-[[3-[2,6-diethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methoxy]-2,3-dihydrofuro[3,2-c]pyridin-3-yl]acetic acid |
| SMILES | CCc1cc(OCCCS(C)(=O)=O)cc(CC)c1-c1cccc(COc2cc3c(cn2)C(CC(=O)O)CO3)c1 |
| InChI | InChI=1S/C30H35NO7S/c1-4-21-13-25(36-10-7-11-39(3,34)35)14-22(5-2)30(21)23-9-6-8-20(12-23)18-38-28-16-27-26(17-31-28)24(19-37-27)15-29(32)33/h6,8-9,12-14,16-17,24H,4-5,7,10-11,15,18-19H2,1-3H3,(H,32,33) |
| InChIKey | QNORXLJRLWYMFJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 112.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|