C34H61N5O10S — CID 121472323
[(2R)-3-[(2S)-2-amino-3-oxo-3-[[1-[(3,4,5,6-tetrahydroxyoxan-2-yl)methyl]triazol-4-yl]amino]propyl]sulfanyl-2-decanoyloxypropyl] decanoate (PubChem CID 121472323) has the molecular formula C34H61N5O10S and a molecular weight of 731.95 g/mol. Its IUPAC name is [(2R)-3-[(2S)-2-amino-3-oxo-3-[[1-[(3,4,5,6-tetrahydroxyoxan-2-yl)methyl]triazol-4-yl]amino]propyl]sulfanyl-2-decanoyloxypropyl] decanoate.
| Compound Name | [(2R)-3-[(2S)-2-amino-3-oxo-3-[[1-[(3,4,5,6-tetrahydroxyoxan-2-yl)methyl]triazol-4-yl]amino]propyl]sulfanyl-2-decanoyloxypropyl] decanoate |
|---|---|
| PubChem CID | 121472323 |
| Molecular Formula | C34H61N5O10S |
| Molecular Weight | 731.95 g/mol |
| Exact Mass | 731.41 |
| IUPAC Name | [(2R)-3-[(2S)-2-amino-3-oxo-3-[[1-[(3,4,5,6-tetrahydroxyoxan-2-yl)methyl]triazol-4-yl]amino]propyl]sulfanyl-2-decanoyloxypropyl] decanoate |
| SMILES | CCCCCCCCCC(=O)OC[C@H](CSC[C@@H](N)C(=O)Nc1cn(CC2OC(O)C(O)C(O)C2O)nn1)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C34H61N5O10S/c1-3-5-7-9-11-13-15-17-28(40)47-21-24(48-29(41)18-16-14-12-10-8-6-4-2)22-50-23-25(35)33(45)36-27-20-39(38-37-27)19-26-30(42)31(43)32(44)34(46)49-26/h20,24-26,30-32,34,42-44,46H,3-19,21-23,35H2,1-2H3,(H,36,45)/t24-,25-,26?,30?,31?,32?,34?/m1/s1 |
| InChIKey | IJQKMTCCYWDADE-VBGPPVFGSA-N |
| XLogP | 2.81 |
| TPSA | 228.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.95 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|