About 4,5-dichloro-2-methylpyridazin-3-one;hydrochloride
4,5-dichloro-2-methylpyridazin-3-one;hydrochloride (PubChem CID 121472658) has the molecular formula C5H5Cl3N2O
and a molecular weight of 215.47 g/mol. Its IUPAC name is 4,5-dichloro-2-methylpyridazin-3-one;hydrochloride.
Molecular Properties
| Compound Name | 4,5-dichloro-2-methylpyridazin-3-one;hydrochloride |
| PubChem CID | 121472658 |
| Molecular Formula | C5H5Cl3N2O |
| Molecular Weight | 215.47 g/mol |
| Exact Mass | 213.95 |
| IUPAC Name | 4,5-dichloro-2-methylpyridazin-3-one;hydrochloride |
| SMILES | Cl.Cn1ncc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C5H4Cl2N2O.ClH/c1-9-5(10)4(7)3(6)2-8-9;/h2H,1H3;1H |
| InChIKey | JXVJWHCFQXOOJC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.47 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dichloro-2-methylpyridazin-3-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-2-methylpyridazin-3-one;hydrochloride?
The IUPAC name of 4,5-dichloro-2-methylpyridazin-3-one;hydrochloride (CID 121472658) is 4,5-dichloro-2-methylpyridazin-3-one;hydrochloride.
What is the SMILES notation for 4,5-dichloro-2-methylpyridazin-3-one;hydrochloride?
The canonical SMILES for 4,5-dichloro-2-methylpyridazin-3-one;hydrochloride is Cl.Cn1ncc(Cl)c(Cl)c1=O.
What is the InChIKey of 4,5-dichloro-2-methylpyridazin-3-one;hydrochloride?
The InChIKey is JXVJWHCFQXOOJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4Cl2N2O.ClH/c1-9-5(10)4(7)3(6)2-8-9;/h2H,1H3;1H.
What are the key properties of 4,5-dichloro-2-methylpyridazin-3-one;hydrochloride?
4,5-dichloro-2-methylpyridazin-3-one;hydrochloride has a molecular weight of 215.47 g/mol, XLogP of 1.51, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-2-methylpyridazin-3-one;hydrochloride is sourced from PubChem (CID 121472658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).