About 1-(4,5-dihydro-1H-imidazol-2-yl)-4-ethylpiperazine
1-(4,5-dihydro-1H-imidazol-2-yl)-4-ethylpiperazine (PubChem CID 121472706) has the molecular formula C9H18N4
and a molecular weight of 182.27 g/mol. Its IUPAC name is 1-(4,5-dihydro-1H-imidazol-2-yl)-4-ethylpiperazine.
Molecular Properties
| Compound Name | 1-(4,5-dihydro-1H-imidazol-2-yl)-4-ethylpiperazine |
| PubChem CID | 121472706 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 1-(4,5-dihydro-1H-imidazol-2-yl)-4-ethylpiperazine |
| SMILES | CCN1CCN(C2=NCCN2)CC1 |
| InChI | InChI=1S/C9H18N4/c1-2-12-5-7-13(8-6-12)9-10-3-4-11-9/h2-8H2,1H3,(H,10,11) |
| InChIKey | HOMWFFAYDLGSTQ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4,5-dihydro-1H-imidazol-2-yl)-4-ethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-yl)-4-ethylpiperazine?
The IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-yl)-4-ethylpiperazine (CID 121472706) is 1-(4,5-dihydro-1H-imidazol-2-yl)-4-ethylpiperazine.
What is the SMILES notation for 1-(4,5-dihydro-1H-imidazol-2-yl)-4-ethylpiperazine?
The canonical SMILES for 1-(4,5-dihydro-1H-imidazol-2-yl)-4-ethylpiperazine is CCN1CCN(C2=NCCN2)CC1.
What is the InChIKey of 1-(4,5-dihydro-1H-imidazol-2-yl)-4-ethylpiperazine?
The InChIKey is HOMWFFAYDLGSTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4/c1-2-12-5-7-13(8-6-12)9-10-3-4-11-9/h2-8H2,1H3,(H,10,11).
What are the key properties of 1-(4,5-dihydro-1H-imidazol-2-yl)-4-ethylpiperazine?
1-(4,5-dihydro-1H-imidazol-2-yl)-4-ethylpiperazine has a molecular weight of 182.27 g/mol, XLogP of -0.42, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dihydro-1H-imidazol-2-yl)-4-ethylpiperazine is sourced from PubChem (CID 121472706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).