About 4-[3-(2,6-dichloro-3-fluorobenzoyl)indolizin-1-yl]-N,N-dimethylbenzamide
4-[3-(2,6-dichloro-3-fluorobenzoyl)indolizin-1-yl]-N,N-dimethylbenzamide (PubChem CID 121472927) has the molecular formula C24H17Cl2FN2O2
and a molecular weight of 455.32 g/mol. Its IUPAC name is 4-[3-(2,6-dichloro-3-fluorobenzoyl)indolizin-1-yl]-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 4-[3-(2,6-dichloro-3-fluorobenzoyl)indolizin-1-yl]-N,N-dimethylbenzamide |
| PubChem CID | 121472927 |
| Molecular Formula | C24H17Cl2FN2O2 |
| Molecular Weight | 455.32 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | 4-[3-(2,6-dichloro-3-fluorobenzoyl)indolizin-1-yl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(-c2cc(C(=O)c3c(Cl)ccc(F)c3Cl)n3ccccc23)cc1 |
| InChI | InChI=1S/C24H17Cl2FN2O2/c1-28(2)24(31)15-8-6-14(7-9-15)16-13-20(29-12-4-3-5-19(16)29)23(30)21-17(25)10-11-18(27)22(21)26/h3-13H,1-2H3 |
| InChIKey | OJVVAPUBXAZINB-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.32 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(2,6-dichloro-3-fluorobenzoyl)indolizin-1-yl]-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2,6-dichloro-3-fluorobenzoyl)indolizin-1-yl]-N,N-dimethylbenzamide?
The IUPAC name of 4-[3-(2,6-dichloro-3-fluorobenzoyl)indolizin-1-yl]-N,N-dimethylbenzamide (CID 121472927) is 4-[3-(2,6-dichloro-3-fluorobenzoyl)indolizin-1-yl]-N,N-dimethylbenzamide.
What is the SMILES notation for 4-[3-(2,6-dichloro-3-fluorobenzoyl)indolizin-1-yl]-N,N-dimethylbenzamide?
The canonical SMILES for 4-[3-(2,6-dichloro-3-fluorobenzoyl)indolizin-1-yl]-N,N-dimethylbenzamide is CN(C)C(=O)c1ccc(-c2cc(C(=O)c3c(Cl)ccc(F)c3Cl)n3ccccc23)cc1.
What is the InChIKey of 4-[3-(2,6-dichloro-3-fluorobenzoyl)indolizin-1-yl]-N,N-dimethylbenzamide?
The InChIKey is OJVVAPUBXAZINB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17Cl2FN2O2/c1-28(2)24(31)15-8-6-14(7-9-15)16-13-20(29-12-4-3-5-19(16)29)23(30)21-17(25)10-11-18(27)22(21)26/h3-13H,1-2H3.
What are the key properties of 4-[3-(2,6-dichloro-3-fluorobenzoyl)indolizin-1-yl]-N,N-dimethylbenzamide?
4-[3-(2,6-dichloro-3-fluorobenzoyl)indolizin-1-yl]-N,N-dimethylbenzamide has a molecular weight of 455.32 g/mol, XLogP of 5.99, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2,6-dichloro-3-fluorobenzoyl)indolizin-1-yl]-N,N-dimethylbenzamide is sourced from PubChem (CID 121472927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).