C15H27F — CID 121473235
(1E,3R,6R,9R)-9-(fluoromethyl)-3-methyl-6-propan-2-ylcyclodecene (PubChem CID 121473235) has the molecular formula C15H27F and a molecular weight of 226.38 g/mol. Its IUPAC name is (1E,3R,6R,9R)-9-(fluoromethyl)-3-methyl-6-propan-2-ylcyclodecene.
| Compound Name | (1E,3R,6R,9R)-9-(fluoromethyl)-3-methyl-6-propan-2-ylcyclodecene |
|---|---|
| PubChem CID | 121473235 |
| Molecular Formula | C15H27F |
| Molecular Weight | 226.38 g/mol |
| Exact Mass | 226.21 |
| IUPAC Name | (1E,3R,6R,9R)-9-(fluoromethyl)-3-methyl-6-propan-2-ylcyclodecene |
| SMILES | CC(C)[C@H]1CC[C@@H](CF)C/C=C/[C@H](C)CC1 |
| InChI | InChI=1S/C15H27F/c1-12(2)15-9-7-13(3)5-4-6-14(11-16)8-10-15/h4-5,12-15H,6-11H2,1-3H3/b5-4+/t13-,14-,15+/m0/s1 |
| InChIKey | LLGIPICWGDKPIF-BYOPPYECSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.38 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|