C23H17ClN2O3 — CID 121473532
7-chloro-3-[2-(6-ethenyl-1H-indol-3-yl)-2-oxoethoxy]naphthalene-2-carboxamide (PubChem CID 121473532) has the molecular formula C23H17ClN2O3 and a molecular weight of 404.85 g/mol. Its IUPAC name is 7-chloro-3-[2-(6-ethenyl-1H-indol-3-yl)-2-oxoethoxy]naphthalene-2-carboxamide.
| Compound Name | 7-chloro-3-[2-(6-ethenyl-1H-indol-3-yl)-2-oxoethoxy]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 121473532 |
| Molecular Formula | C23H17ClN2O3 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 7-chloro-3-[2-(6-ethenyl-1H-indol-3-yl)-2-oxoethoxy]naphthalene-2-carboxamide |
| SMILES | C=Cc1ccc2c(C(=O)COc3cc4ccc(Cl)cc4cc3C(N)=O)c[nH]c2c1 |
| InChI | InChI=1S/C23H17ClN2O3/c1-2-13-3-6-17-19(11-26-20(17)7-13)21(27)12-29-22-10-14-4-5-16(24)8-15(14)9-18(22)23(25)28/h2-11,26H,1,12H2,(H2,25,28) |
| InChIKey | ZZDXJZYSSCJPTD-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |