C54H54ClN7O4 — CID 121474114
4-[[[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenoxy]methyl-[1-(4-chlorophenyl)cyclohexanecarbonyl]amino]methyl]benzoic acid (PubChem CID 121474114) has the molecular formula C54H54ClN7O4 and a molecular weight of 900.52 g/mol. Its IUPAC name is 4-[[[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenoxy]methyl-[1-(4-chlorophenyl)cyclohexanecarbonyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenoxy]methyl-[1-(4-chlorophenyl)cyclohexanecarbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 121474114 |
| Molecular Formula | C54H54ClN7O4 |
| Molecular Weight | 900.52 g/mol |
| Exact Mass | 899.39 |
| IUPAC Name | 4-[[[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenoxy]methyl-[1-(4-chlorophenyl)cyclohexanecarbonyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CN(COc2cc(CN(Cc3ccccn3)Cc3ccccn3)cc(CN(Cc3ccccn3)Cc3ccccn3)c2)C(=O)C2(c3ccc(Cl)cc3)CCCCC2)cc1 |
| InChI | InChI=1S/C54H54ClN7O4/c55-46-22-20-45(21-23-46)54(24-6-1-7-25-54)53(65)62(35-41-16-18-44(19-17-41)52(63)64)40-66-51-31-42(33-60(36-47-12-2-8-26-56-47)37-48-13-3-9-27-57-48)30-43(32-51)34-61(38-49-14-4-10-28-58-49)39-50-15-5-11-29-59-50/h2-5,8-23,26-32H,1,6-7,24-25,33-40H2,(H,63,64) |
| InChIKey | RIKHJSUSURKTQR-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.52 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|