C11H23ClO2 — CID 121474157
(2R)-1-chloro-2,5-dimethoxy-3,3,5-trimethylhexane (PubChem CID 121474157) has the molecular formula C11H23ClO2 and a molecular weight of 222.76 g/mol. Its IUPAC name is (2R)-1-chloro-2,5-dimethoxy-3,3,5-trimethylhexane.
| Compound Name | (2R)-1-chloro-2,5-dimethoxy-3,3,5-trimethylhexane |
|---|---|
| PubChem CID | 121474157 |
| Molecular Formula | C11H23ClO2 |
| Molecular Weight | 222.76 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (2R)-1-chloro-2,5-dimethoxy-3,3,5-trimethylhexane |
| SMILES | CO[C@@H](CCl)C(C)(C)CC(C)(C)OC |
| InChI | InChI=1S/C11H23ClO2/c1-10(2,9(7-12)13-5)8-11(3,4)14-6/h9H,7-8H2,1-6H3/t9-/m0/s1 |
| InChIKey | VWKGKTMEHIHHQH-VIFPVBQESA-N |
| XLogP | 3.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.76 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|