C23H19ClF2N4O4 — CID 121474334
N-[4-[chloro(difluoro)methoxy]phenyl]-6-[(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]-5-(5-ethynyl-1H-pyrrol-2-yl)pyridine-3-carboxamide (PubChem CID 121474334) has the molecular formula C23H19ClF2N4O4 and a molecular weight of 488.88 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-6-[(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]-5-(5-ethynyl-1H-pyrrol-2-yl)pyridine-3-carboxamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-6-[(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]-5-(5-ethynyl-1H-pyrrol-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 121474334 |
| Molecular Formula | C23H19ClF2N4O4 |
| Molecular Weight | 488.88 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-6-[(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]-5-(5-ethynyl-1H-pyrrol-2-yl)pyridine-3-carboxamide |
| SMILES | C#Cc1ccc(-c2cc(C(=O)Nc3ccc(OC(F)(F)Cl)cc3)cnc2N2C[C@H](O)[C@@H](O)C2)[nH]1 |
| InChI | InChI=1S/C23H19ClF2N4O4/c1-2-14-5-8-18(28-14)17-9-13(10-27-21(17)30-11-19(31)20(32)12-30)22(33)29-15-3-6-16(7-4-15)34-23(24,25)26/h1,3-10,19-20,28,31-32H,11-12H2,(H,29,33)/t19-,20-/m0/s1 |
| InChIKey | VCWXAYPUVVOJBV-PMACEKPBSA-N |
| XLogP | 3.02 |
| TPSA | 110.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.88 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|