C10H19NO2 — CID 121474512
(2,2,5-trimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-4-yl)methanol (PubChem CID 121474512) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is (2,2,5-trimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-4-yl)methanol.
| Compound Name | (2,2,5-trimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-4-yl)methanol |
|---|---|
| PubChem CID | 121474512 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (2,2,5-trimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-4-yl)methanol |
| SMILES | CN1CC2OC(C)(C)CC2C1CO |
| InChI | InChI=1S/C10H19NO2/c1-10(2)4-7-8(6-12)11(3)5-9(7)13-10/h7-9,12H,4-6H2,1-3H3 |
| InChIKey | LUDFUNAJDRYENL-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |