C15H21ClO — CID 121475344
(4E,6E)-7-chloro-9-methyl-3-methylidene-6-prop-1-en-2-yldeca-4,6,8-trien-4-ol (PubChem CID 121475344) has the molecular formula C15H21ClO and a molecular weight of 252.78 g/mol. Its IUPAC name is (4E,6E)-7-chloro-9-methyl-3-methylidene-6-prop-1-en-2-yldeca-4,6,8-trien-4-ol.
| Compound Name | (4E,6E)-7-chloro-9-methyl-3-methylidene-6-prop-1-en-2-yldeca-4,6,8-trien-4-ol |
|---|---|
| PubChem CID | 121475344 |
| Molecular Formula | C15H21ClO |
| Molecular Weight | 252.78 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | (4E,6E)-7-chloro-9-methyl-3-methylidene-6-prop-1-en-2-yldeca-4,6,8-trien-4-ol |
| SMILES | C=C(CC)/C(O)=C\C(C(=C)C)=C(/Cl)C=C(C)C |
| InChI | InChI=1S/C15H21ClO/c1-7-12(6)15(17)9-13(11(4)5)14(16)8-10(2)3/h8-9,17H,4,6-7H2,1-3,5H3/b14-13+,15-9+ |
| InChIKey | RYHDJKNGBCITHR-FYXBLBNSSA-N |
| XLogP | 5.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.78 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|