C27H44O6 — CID 121475533
(4E,12E,14E,16E)-1,6-dihydroxy-7,18-dimethoxy-3,5,9,11,17-pentamethylicosa-4,12,14,16-tetraene-2,8-dione (PubChem CID 121475533) has the molecular formula C27H44O6 and a molecular weight of 464.64 g/mol. Its IUPAC name is (4E,12E,14E,16E)-1,6-dihydroxy-7,18-dimethoxy-3,5,9,11,17-pentamethylicosa-4,12,14,16-tetraene-2,8-dione.
| Compound Name | (4E,12E,14E,16E)-1,6-dihydroxy-7,18-dimethoxy-3,5,9,11,17-pentamethylicosa-4,12,14,16-tetraene-2,8-dione |
|---|---|
| PubChem CID | 121475533 |
| Molecular Formula | C27H44O6 |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | (4E,12E,14E,16E)-1,6-dihydroxy-7,18-dimethoxy-3,5,9,11,17-pentamethylicosa-4,12,14,16-tetraene-2,8-dione |
| SMILES | CCC(OC)/C(C)=C/C=C/C=C/C(C)CC(C)C(=O)C(OC)C(O)/C(C)=C/C(C)C(=O)CO |
| InChI | InChI=1S/C27H44O6/c1-9-24(32-7)19(3)14-12-10-11-13-18(2)15-21(5)25(30)27(33-8)26(31)22(6)16-20(4)23(29)17-28/h10-14,16,18,20-21,24,26-28,31H,9,15,17H2,1-8H3/b12-10+,13-11+,19-14+,22-16+ |
| InChIKey | NMVJBBVREBTIFA-PREOOGABSA-N |
| XLogP | 4.22 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|