C26H19F5N6O2 — CID 121475580
1-[3-[4-amino-3-[2-fluoro-4-(2,3,5,6-tetrafluorobenzoyl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 121475580) has the molecular formula C26H19F5N6O2 and a molecular weight of 542.47 g/mol. Its IUPAC name is 1-[3-[4-amino-3-[2-fluoro-4-(2,3,5,6-tetrafluorobenzoyl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-amino-3-[2-fluoro-4-(2,3,5,6-tetrafluorobenzoyl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 121475580 |
| Molecular Formula | C26H19F5N6O2 |
| Molecular Weight | 542.47 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | 1-[3-[4-amino-3-[2-fluoro-4-(2,3,5,6-tetrafluorobenzoyl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(n2nc(-c3ccc(C(=O)c4c(F)c(F)cc(F)c4F)cc3F)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C26H19F5N6O2/c1-2-18(38)36-7-3-4-13(10-36)37-26-20(25(32)33-11-34-26)23(35-37)14-6-5-12(8-15(14)27)24(39)19-21(30)16(28)9-17(29)22(19)31/h2,5-6,8-9,11,13H,1,3-4,7,10H2,(H2,32,33,34) |
| InChIKey | IYGIBHMRQVRRTF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|