C28H28FN7O5 — CID 121475581
tert-butyl 3-[4-amino-3-[2-fluoro-4-(2-nitrobenzoyl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carboxylate (PubChem CID 121475581) has the molecular formula C28H28FN7O5 and a molecular weight of 561.57 g/mol. Its IUPAC name is tert-butyl 3-[4-amino-3-[2-fluoro-4-(2-nitrobenzoyl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-amino-3-[2-fluoro-4-(2-nitrobenzoyl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 121475581 |
| Molecular Formula | C28H28FN7O5 |
| Molecular Weight | 561.57 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | tert-butyl 3-[4-amino-3-[2-fluoro-4-(2-nitrobenzoyl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(n2nc(-c3ccc(C(=O)c4ccccc4[N+](=O)[O-])cc3F)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C28H28FN7O5/c1-28(2,3)41-27(38)34-12-6-7-17(14-34)35-26-22(25(30)31-15-32-26)23(33-35)18-11-10-16(13-20(18)29)24(37)19-8-4-5-9-21(19)36(39)40/h4-5,8-11,13,15,17H,6-7,12,14H2,1-3H3,(H2,30,31,32) |
| InChIKey | XLDBKJYRDYXIAX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 159.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.57 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|