C33H24N4O4 — CID 121475755
(12aS)-9-[[(12aS)-6-oxo-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-9-yl]oxymethoxy]-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-6-one (PubChem CID 121475755) has the molecular formula C33H24N4O4 and a molecular weight of 540.58 g/mol. Its IUPAC name is (12aS)-9-[[(12aS)-6-oxo-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-9-yl]oxymethoxy]-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-6-one.
| Compound Name | (12aS)-9-[[(12aS)-6-oxo-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-9-yl]oxymethoxy]-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 121475755 |
| Molecular Formula | C33H24N4O4 |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | (12aS)-9-[[(12aS)-6-oxo-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-9-yl]oxymethoxy]-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-6-one |
| SMILES | O=C1c2ccc(OCOc3ccc4c(c3)N=C[C@@H]3Cc5ccccc5N3C4=O)cc2N=C[C@@H]2Cc3ccccc3N12 |
| InChI | InChI=1S/C33H24N4O4/c38-32-26-11-9-24(15-28(26)34-17-22-13-20-5-1-3-7-30(20)36(22)32)40-19-41-25-10-12-27-29(16-25)35-18-23-14-21-6-2-4-8-31(21)37(23)33(27)39/h1-12,15-18,22-23H,13-14,19H2/t22-,23-/m0/s1 |
| InChIKey | NPEVLVZNVGLIBF-GOTSBHOMSA-N |
| XLogP | 5.68 |
| TPSA | 83.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|