(2R)-2-methyl-3,4-dihydropyran-2-carboxylic acid

C7H10O3 — CID 121475933

IUPAC(2R)-2-methyl-3,4-dihydropyran-2-carboxylic acid
SMILESC[C@]1(C(=O)O)CCC=CO1
InChIInChI=1S/C7H10O3/c1-7(6(8)9)4-2-3-5-10-7/h3,5H,2,4H2,1H3,(H,8,9)/t7-/m1/s1
InChIKeyUXZQCTOFSDBNQI-SSDOTTSWSA-N
MW142.15 g/mol
LogP1.15
Rot. Bonds1

About (2R)-2-methyl-3,4-dihydropyran-2-carboxylic acid

(2R)-2-methyl-3,4-dihydropyran-2-carboxylic acid (PubChem CID 121475933) has the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. Its IUPAC name is (2R)-2-methyl-3,4-dihydropyran-2-carboxylic acid.

Molecular Properties

Compound Name(2R)-2-methyl-3,4-dihydropyran-2-carboxylic acid
PubChem CID121475933
Molecular FormulaC7H10O3
Molecular Weight142.15 g/mol
Exact Mass142.06
IUPAC Name(2R)-2-methyl-3,4-dihydropyran-2-carboxylic acid
SMILESC[C@]1(C(=O)O)CCC=CO1
InChIInChI=1S/C7H10O3/c1-7(6(8)9)4-2-3-5-10-7/h3,5H,2,4H2,1H3,(H,8,9)/t7-/m1/s1
InChIKeyUXZQCTOFSDBNQI-SSDOTTSWSA-N
XLogP1.15
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.15
LogP ≤ 51.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (2R)-2-methyl-3,4-dihydropyran-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-methyl-3,4-dihydropyran-2-carboxylic acid?
The IUPAC name of (2R)-2-methyl-3,4-dihydropyran-2-carboxylic acid (CID 121475933) is (2R)-2-methyl-3,4-dihydropyran-2-carboxylic acid.
What is the SMILES notation for (2R)-2-methyl-3,4-dihydropyran-2-carboxylic acid?
The canonical SMILES for (2R)-2-methyl-3,4-dihydropyran-2-carboxylic acid is C[C@]1(C(=O)O)CCC=CO1.
What is the InChIKey of (2R)-2-methyl-3,4-dihydropyran-2-carboxylic acid?
The InChIKey is UXZQCTOFSDBNQI-SSDOTTSWSA-N. The full InChI is InChI=1S/C7H10O3/c1-7(6(8)9)4-2-3-5-10-7/h3,5H,2,4H2,1H3,(H,8,9)/t7-/m1/s1.
What are the key properties of (2R)-2-methyl-3,4-dihydropyran-2-carboxylic acid?
(2R)-2-methyl-3,4-dihydropyran-2-carboxylic acid has a molecular weight of 142.15 g/mol, XLogP of 1.15, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-methyl-3,4-dihydropyran-2-carboxylic acid is sourced from PubChem (CID 121475933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).