C12H16F4 — CID 121476153
5,5,6,6-tetrafluoro-1,4-dipropylcyclohexa-1,3-diene (PubChem CID 121476153) has the molecular formula C12H16F4 and a molecular weight of 236.25 g/mol. Its IUPAC name is 5,5,6,6-tetrafluoro-1,4-dipropylcyclohexa-1,3-diene.
| Compound Name | 5,5,6,6-tetrafluoro-1,4-dipropylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 121476153 |
| Molecular Formula | C12H16F4 |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 5,5,6,6-tetrafluoro-1,4-dipropylcyclohexa-1,3-diene |
| SMILES | CCCC1=CC=C(CCC)C(F)(F)C1(F)F |
| InChI | InChI=1S/C12H16F4/c1-3-5-9-7-8-10(6-4-2)12(15,16)11(9,13)14/h7-8H,3-6H2,1-2H3 |
| InChIKey | AONWSDZIIKSEDN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|