C25H38F4O — CID 121476157
5,5,6,6-tetrafluoro-1-propyl-4-[[4-(4-propylcyclohexyl)cyclohexyl]methoxy]cyclohexa-1,3-diene (PubChem CID 121476157) has the molecular formula C25H38F4O and a molecular weight of 430.57 g/mol. Its IUPAC name is 5,5,6,6-tetrafluoro-1-propyl-4-[[4-(4-propylcyclohexyl)cyclohexyl]methoxy]cyclohexa-1,3-diene.
| Compound Name | 5,5,6,6-tetrafluoro-1-propyl-4-[[4-(4-propylcyclohexyl)cyclohexyl]methoxy]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 121476157 |
| Molecular Formula | C25H38F4O |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | 5,5,6,6-tetrafluoro-1-propyl-4-[[4-(4-propylcyclohexyl)cyclohexyl]methoxy]cyclohexa-1,3-diene |
| SMILES | CCCC1=CC=C(OCC2CCC(C3CCC(CCC)CC3)CC2)C(F)(F)C1(F)F |
| InChI | InChI=1S/C25H38F4O/c1-3-5-18-7-11-20(12-8-18)21-13-9-19(10-14-21)17-30-23-16-15-22(6-4-2)24(26,27)25(23,28)29/h15-16,18-21H,3-14,17H2,1-2H3 |
| InChIKey | LFNRFGNSLFVRBS-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|