C19H28F4O — CID 121476164
1-ethoxy-5,5,6,6-tetrafluoro-4-(4-pentylcyclohexyl)cyclohexa-1,3-diene (PubChem CID 121476164) has the molecular formula C19H28F4O and a molecular weight of 348.42 g/mol. Its IUPAC name is 1-ethoxy-5,5,6,6-tetrafluoro-4-(4-pentylcyclohexyl)cyclohexa-1,3-diene.
| Compound Name | 1-ethoxy-5,5,6,6-tetrafluoro-4-(4-pentylcyclohexyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 121476164 |
| Molecular Formula | C19H28F4O |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 1-ethoxy-5,5,6,6-tetrafluoro-4-(4-pentylcyclohexyl)cyclohexa-1,3-diene |
| SMILES | CCCCCC1CCC(C2=CC=C(OCC)C(F)(F)C2(F)F)CC1 |
| InChI | InChI=1S/C19H28F4O/c1-3-5-6-7-14-8-10-15(11-9-14)16-12-13-17(24-4-2)19(22,23)18(16,20)21/h12-15H,3-11H2,1-2H3 |
| InChIKey | IVXOKWQBZPZBKY-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|