C16H20F4O — CID 121476167
1-(4-ethenylcyclohexyl)-4-ethoxy-5,5,6,6-tetrafluorocyclohexa-1,3-diene (PubChem CID 121476167) has the molecular formula C16H20F4O and a molecular weight of 304.33 g/mol. Its IUPAC name is 1-(4-ethenylcyclohexyl)-4-ethoxy-5,5,6,6-tetrafluorocyclohexa-1,3-diene.
| Compound Name | 1-(4-ethenylcyclohexyl)-4-ethoxy-5,5,6,6-tetrafluorocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 121476167 |
| Molecular Formula | C16H20F4O |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 1-(4-ethenylcyclohexyl)-4-ethoxy-5,5,6,6-tetrafluorocyclohexa-1,3-diene |
| SMILES | C=CC1CCC(C2=CC=C(OCC)C(F)(F)C2(F)F)CC1 |
| InChI | InChI=1S/C16H20F4O/c1-3-11-5-7-12(8-6-11)13-9-10-14(21-4-2)16(19,20)15(13,17)18/h3,9-12H,1,4-8H2,2H3 |
| InChIKey | NNHJCKBKQBUMHY-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|