C16H22F4O — CID 121476176
2-(4-ethyl-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)-5-propyloxane (PubChem CID 121476176) has the molecular formula C16H22F4O and a molecular weight of 306.34 g/mol. Its IUPAC name is 2-(4-ethyl-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)-5-propyloxane.
| Compound Name | 2-(4-ethyl-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)-5-propyloxane |
|---|---|
| PubChem CID | 121476176 |
| Molecular Formula | C16H22F4O |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 2-(4-ethyl-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)-5-propyloxane |
| SMILES | CCCC1CCC(C2=CC=C(CC)C(F)(F)C2(F)F)OC1 |
| InChI | InChI=1S/C16H22F4O/c1-3-5-11-6-9-14(21-10-11)13-8-7-12(4-2)15(17,18)16(13,19)20/h7-8,11,14H,3-6,9-10H2,1-2H3 |
| InChIKey | HVMJCNWXIDBKHM-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|