C18H18F8 — CID 121476184
5,5,6,6-tetrafluoro-1-propyl-4-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-diene (PubChem CID 121476184) has the molecular formula C18H18F8 and a molecular weight of 386.33 g/mol. Its IUPAC name is 5,5,6,6-tetrafluoro-1-propyl-4-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-diene.
| Compound Name | 5,5,6,6-tetrafluoro-1-propyl-4-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 121476184 |
| Molecular Formula | C18H18F8 |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 5,5,6,6-tetrafluoro-1-propyl-4-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-diene |
| SMILES | CCCC1=CC=C(C2=CC=C(CCC)C(F)(F)C2(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C18H18F8/c1-3-5-11-7-9-13(17(23,24)15(11,19)20)14-10-8-12(6-4-2)16(21,22)18(14,25)26/h7-10H,3-6H2,1-2H3 |
| InChIKey | FNRYBYAWDFKBNT-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|