C18H26F4O2 — CID 121476191
2-[2-(4-ethoxy-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)ethyl]-5-propyloxane (PubChem CID 121476191) has the molecular formula C18H26F4O2 and a molecular weight of 350.40 g/mol. Its IUPAC name is 2-[2-(4-ethoxy-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)ethyl]-5-propyloxane.
| Compound Name | 2-[2-(4-ethoxy-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)ethyl]-5-propyloxane |
|---|---|
| PubChem CID | 121476191 |
| Molecular Formula | C18H26F4O2 |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 2-[2-(4-ethoxy-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)ethyl]-5-propyloxane |
| SMILES | CCCC1CCC(CCC2=CC=C(OCC)C(F)(F)C2(F)F)OC1 |
| InChI | InChI=1S/C18H26F4O2/c1-3-5-13-6-9-15(24-12-13)10-7-14-8-11-16(23-4-2)18(21,22)17(14,19)20/h8,11,13,15H,3-7,9-10,12H2,1-2H3 |
| InChIKey | VVSLAYYDXDCPDT-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|