C20H22F8 — CID 121476194
5,5,6,6-tetrafluoro-1-propyl-4-[2-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)ethyl]cyclohexa-1,3-diene (PubChem CID 121476194) has the molecular formula C20H22F8 and a molecular weight of 414.38 g/mol. Its IUPAC name is 5,5,6,6-tetrafluoro-1-propyl-4-[2-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)ethyl]cyclohexa-1,3-diene.
| Compound Name | 5,5,6,6-tetrafluoro-1-propyl-4-[2-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)ethyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 121476194 |
| Molecular Formula | C20H22F8 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 5,5,6,6-tetrafluoro-1-propyl-4-[2-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)ethyl]cyclohexa-1,3-diene |
| SMILES | CCCC1=CC=C(CCC2=CC=C(CCC)C(F)(F)C2(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C20H22F8/c1-3-5-13-7-9-15(19(25,26)17(13,21)22)11-12-16-10-8-14(6-4-2)18(23,24)20(16,27)28/h7-10H,3-6,11-12H2,1-2H3 |
| InChIKey | DKKMTACZAULEJO-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|