C18H24F6O — CID 121476207
1-[difluoro-(4-propylcyclohexyl)methoxy]-4-ethyl-5,5,6,6-tetrafluorocyclohexa-1,3-diene (PubChem CID 121476207) has the molecular formula C18H24F6O and a molecular weight of 370.38 g/mol. Its IUPAC name is 1-[difluoro-(4-propylcyclohexyl)methoxy]-4-ethyl-5,5,6,6-tetrafluorocyclohexa-1,3-diene.
| Compound Name | 1-[difluoro-(4-propylcyclohexyl)methoxy]-4-ethyl-5,5,6,6-tetrafluorocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 121476207 |
| Molecular Formula | C18H24F6O |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 1-[difluoro-(4-propylcyclohexyl)methoxy]-4-ethyl-5,5,6,6-tetrafluorocyclohexa-1,3-diene |
| SMILES | CCCC1CCC(C(F)(F)OC2=CC=C(CC)C(F)(F)C2(F)F)CC1 |
| InChI | InChI=1S/C18H24F6O/c1-3-5-12-6-8-14(9-7-12)18(23,24)25-15-11-10-13(4-2)16(19,20)17(15,21)22/h10-12,14H,3-9H2,1-2H3 |
| InChIKey | FVFJONMTQREYLX-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|