C17H22F6O — CID 121476214
1-[difluoro-(4-methylcyclohexyl)oxymethyl]-5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-diene (PubChem CID 121476214) has the molecular formula C17H22F6O and a molecular weight of 356.35 g/mol. Its IUPAC name is 1-[difluoro-(4-methylcyclohexyl)oxymethyl]-5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-diene.
| Compound Name | 1-[difluoro-(4-methylcyclohexyl)oxymethyl]-5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 121476214 |
| Molecular Formula | C17H22F6O |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 1-[difluoro-(4-methylcyclohexyl)oxymethyl]-5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-diene |
| SMILES | CCCC1=CC=C(C(F)(F)OC2CCC(C)CC2)C(F)(F)C1(F)F |
| InChI | InChI=1S/C17H22F6O/c1-3-4-12-7-10-14(16(20,21)15(12,18)19)17(22,23)24-13-8-5-11(2)6-9-13/h7,10-11,13H,3-6,8-9H2,1-2H3 |
| InChIKey | UVXCTOHOXBYLAH-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|