C18H26F4O — CID 121476215
1-ethyl-5,5,6,6-tetrafluoro-4-[(4-propylcyclohexyl)methoxy]cyclohexa-1,3-diene (PubChem CID 121476215) has the molecular formula C18H26F4O and a molecular weight of 334.40 g/mol. Its IUPAC name is 1-ethyl-5,5,6,6-tetrafluoro-4-[(4-propylcyclohexyl)methoxy]cyclohexa-1,3-diene.
| Compound Name | 1-ethyl-5,5,6,6-tetrafluoro-4-[(4-propylcyclohexyl)methoxy]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 121476215 |
| Molecular Formula | C18H26F4O |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 1-ethyl-5,5,6,6-tetrafluoro-4-[(4-propylcyclohexyl)methoxy]cyclohexa-1,3-diene |
| SMILES | CCCC1CCC(COC2=CC=C(CC)C(F)(F)C2(F)F)CC1 |
| InChI | InChI=1S/C18H26F4O/c1-3-5-13-6-8-14(9-7-13)12-23-16-11-10-15(4-2)17(19,20)18(16,21)22/h10-11,13-14H,3-9,12H2,1-2H3 |
| InChIKey | CWMFDWXLCPLADN-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|