C17H24F4O2 — CID 121476216
5-[(4-ethyl-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)oxymethyl]-2-propyloxane (PubChem CID 121476216) has the molecular formula C17H24F4O2 and a molecular weight of 336.37 g/mol. Its IUPAC name is 5-[(4-ethyl-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)oxymethyl]-2-propyloxane.
| Compound Name | 5-[(4-ethyl-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)oxymethyl]-2-propyloxane |
|---|---|
| PubChem CID | 121476216 |
| Molecular Formula | C17H24F4O2 |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 5-[(4-ethyl-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)oxymethyl]-2-propyloxane |
| SMILES | CCCC1CCC(COC2=CC=C(CC)C(F)(F)C2(F)F)CO1 |
| InChI | InChI=1S/C17H24F4O2/c1-3-5-14-8-6-12(10-22-14)11-23-15-9-7-13(4-2)16(18,19)17(15,20)21/h7,9,12,14H,3-6,8,10-11H2,1-2H3 |
| InChIKey | UWMBFFJHCNOGMU-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|