C21H30F6O — CID 121476223
1-[1,1-difluoro-3-(4-propylcyclohexyl)propoxy]-5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-diene (PubChem CID 121476223) has the molecular formula C21H30F6O and a molecular weight of 412.46 g/mol. Its IUPAC name is 1-[1,1-difluoro-3-(4-propylcyclohexyl)propoxy]-5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-diene.
| Compound Name | 1-[1,1-difluoro-3-(4-propylcyclohexyl)propoxy]-5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 121476223 |
| Molecular Formula | C21H30F6O |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 1-[1,1-difluoro-3-(4-propylcyclohexyl)propoxy]-5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-diene |
| SMILES | CCCC1=CC=C(OC(F)(F)CCC2CCC(CCC)CC2)C(F)(F)C1(F)F |
| InChI | InChI=1S/C21H30F6O/c1-3-5-15-7-9-16(10-8-15)13-14-19(22,23)28-18-12-11-17(6-4-2)20(24,25)21(18,26)27/h11-12,15-16H,3-10,13-14H2,1-2H3 |
| InChIKey | RRSZKAATZLYEBA-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|