C21H32F4O — CID 121476228
5,5,6,6-tetrafluoro-1-propyl-4-[3-(4-propylcyclohexyl)propoxy]cyclohexa-1,3-diene (PubChem CID 121476228) has the molecular formula C21H32F4O and a molecular weight of 376.48 g/mol. Its IUPAC name is 5,5,6,6-tetrafluoro-1-propyl-4-[3-(4-propylcyclohexyl)propoxy]cyclohexa-1,3-diene.
| Compound Name | 5,5,6,6-tetrafluoro-1-propyl-4-[3-(4-propylcyclohexyl)propoxy]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 121476228 |
| Molecular Formula | C21H32F4O |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 5,5,6,6-tetrafluoro-1-propyl-4-[3-(4-propylcyclohexyl)propoxy]cyclohexa-1,3-diene |
| SMILES | CCCC1=CC=C(OCCCC2CCC(CCC)CC2)C(F)(F)C1(F)F |
| InChI | InChI=1S/C21H32F4O/c1-3-6-16-9-11-17(12-10-16)8-5-15-26-19-14-13-18(7-4-2)20(22,23)21(19,24)25/h13-14,16-17H,3-12,15H2,1-2H3 |
| InChIKey | FGXNNGIBYLLKKT-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|