C20H28F4O — CID 121476252
5-propyl-2-[4-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)cyclohexyl]oxane (PubChem CID 121476252) has the molecular formula C20H28F4O and a molecular weight of 360.44 g/mol. Its IUPAC name is 5-propyl-2-[4-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)cyclohexyl]oxane.
| Compound Name | 5-propyl-2-[4-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)cyclohexyl]oxane |
|---|---|
| PubChem CID | 121476252 |
| Molecular Formula | C20H28F4O |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 5-propyl-2-[4-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)cyclohexyl]oxane |
| SMILES | CCCC1CCC(C2CCC(C3=CC=CC(F)(F)C3(F)F)CC2)OC1 |
| InChI | InChI=1S/C20H28F4O/c1-2-4-14-6-11-18(25-13-14)16-9-7-15(8-10-16)17-5-3-12-19(21,22)20(17,23)24/h3,5,12,14-16,18H,2,4,6-11,13H2,1H3 |
| InChIKey | MTDPROPYOYOTOK-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|