C23H34F4O — CID 121476255
5-propyl-2-[4-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)cyclohexyl]oxane (PubChem CID 121476255) has the molecular formula C23H34F4O and a molecular weight of 402.52 g/mol. Its IUPAC name is 5-propyl-2-[4-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)cyclohexyl]oxane.
| Compound Name | 5-propyl-2-[4-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)cyclohexyl]oxane |
|---|---|
| PubChem CID | 121476255 |
| Molecular Formula | C23H34F4O |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | 5-propyl-2-[4-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)cyclohexyl]oxane |
| SMILES | CCCC1=CC=C(C2CCC(C3CCC(CCC)CO3)CC2)C(F)(F)C1(F)F |
| InChI | InChI=1S/C23H34F4O/c1-3-5-16-7-14-21(28-15-16)18-10-8-17(9-11-18)20-13-12-19(6-4-2)22(24,25)23(20,26)27/h12-13,16-18,21H,3-11,14-15H2,1-2H3 |
| InChIKey | HVQUHPIDRRLVJH-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|